C17H27NO3 — CID 67885235
2-acetamido-2-ethylbutanoic acid;1,2,3-trimethylbenzene (PubChem CID 67885235) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-acetamido-2-ethylbutanoic acid;1,2,3-trimethylbenzene.
| Compound Name | 2-acetamido-2-ethylbutanoic acid;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 67885235 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-acetamido-2-ethylbutanoic acid;1,2,3-trimethylbenzene |
| SMILES | CCC(CC)(NC(C)=O)C(=O)O.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12.C8H15NO3/c1-7-5-4-6-8(2)9(7)3;1-4-8(5-2,7(11)12)9-6(3)10/h4-6H,1-3H3;4-5H2,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | NVAVJQAQWMJCHZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |