C19H18FN5O3 — CID 67887431
5-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(1-methoxycyclopentyl)-1,2,4-oxadiazole (PubChem CID 67887431) has the molecular formula C19H18FN5O3 and a molecular weight of 383.38 g/mol. Its IUPAC name is 5-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(1-methoxycyclopentyl)-1,2,4-oxadiazole.
| Compound Name | 5-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(1-methoxycyclopentyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67887431 |
| Molecular Formula | C19H18FN5O3 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(1-methoxycyclopentyl)-1,2,4-oxadiazole |
| SMILES | COC1(c2noc(-c3ncn4c3c(C)[n+]([O-])c3cc(F)ccc34)n2)CCCC1 |
| InChI | InChI=1S/C19H18FN5O3/c1-11-16-15(17-22-18(23-28-17)19(27-2)7-3-4-8-19)21-10-24(16)13-6-5-12(20)9-14(13)25(11)26/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | WUSBHPXCUYUZLB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|