C17H14ClN5O2 — CID 67889552
5-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(2-methylcyclopropyl)-1,2,4-oxadiazole (PubChem CID 67889552) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 5-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(2-methylcyclopropyl)-1,2,4-oxadiazole.
| Compound Name | 5-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(2-methylcyclopropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67889552 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 5-(7-chloro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-3-(2-methylcyclopropyl)-1,2,4-oxadiazole |
| SMILES | Cc1c2c(-c3nc(C4CC4C)no3)ncn2c2ccc(Cl)cc2[n+]1[O-] |
| InChI | InChI=1S/C17H14ClN5O2/c1-8-5-11(8)16-20-17(25-21-16)14-15-9(2)23(24)13-6-10(18)3-4-12(13)22(15)7-19-14/h3-4,6-8,11H,5H2,1-2H3 |
| InChIKey | NXHZETWVRCLYJF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|