About [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol
[3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol (PubChem CID 67888178) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol |
| PubChem CID | 67888178 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol |
| SMILES | OCC1(CO)COC2(CCCC2)O1 |
| InChI | InChI=1S/C9H16O4/c10-5-8(6-11)7-12-9(13-8)3-1-2-4-9/h10-11H,1-7H2 |
| InChIKey | XDMXKAHWWPBCRV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol?
The IUPAC name of [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol (CID 67888178) is [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol.
What is the SMILES notation for [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol?
The canonical SMILES for [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol is OCC1(CO)COC2(CCCC2)O1.
What is the InChIKey of [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol?
The InChIKey is XDMXKAHWWPBCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c10-5-8(6-11)7-12-9(13-8)3-1-2-4-9/h10-11H,1-7H2.
What are the key properties of [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol?
[3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol has a molecular weight of 188.22 g/mol, XLogP of 0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-3-yl]methanol is sourced from PubChem (CID 67888178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).