C20H16N6S — CID 67889369
7-(5-methyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine (PubChem CID 67889369) has the molecular formula C20H16N6S and a molecular weight of 372.46 g/mol. Its IUPAC name is 7-(5-methyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine.
| Compound Name | 7-(5-methyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 67889369 |
| Molecular Formula | C20H16N6S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 7-(5-methyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine |
| SMILES | Cc1ccc2c(c1)nc(-c1cccs1)n2-c1ccc2c(N)nc(N)nc2c1 |
| InChI | InChI=1S/C20H16N6S/c1-11-4-7-16-15(9-11)23-19(17-3-2-8-27-17)26(16)12-5-6-13-14(10-12)24-20(22)25-18(13)21/h2-10H,1H3,(H4,21,22,24,25) |
| InChIKey | YXGIUKWLVPBVRP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |