C14H10BrFN6O — CID 67889411
3-[4-(bromomethyl)triazol-1-yl]-7-fluoro-4-methylimidazo[1,5-a]quinazolin-5-one (PubChem CID 67889411) has the molecular formula C14H10BrFN6O and a molecular weight of 377.18 g/mol. Its IUPAC name is 3-[4-(bromomethyl)triazol-1-yl]-7-fluoro-4-methylimidazo[1,5-a]quinazolin-5-one.
| Compound Name | 3-[4-(bromomethyl)triazol-1-yl]-7-fluoro-4-methylimidazo[1,5-a]quinazolin-5-one |
|---|---|
| PubChem CID | 67889411 |
| Molecular Formula | C14H10BrFN6O |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 3-[4-(bromomethyl)triazol-1-yl]-7-fluoro-4-methylimidazo[1,5-a]quinazolin-5-one |
| SMILES | Cn1c(=O)c2cc(F)ccc2n2cnc(-n3cc(CBr)nn3)c12 |
| InChI | InChI=1S/C14H10BrFN6O/c1-20-13-12(22-6-9(5-15)18-19-22)17-7-21(13)11-3-2-8(16)4-10(11)14(20)23/h2-4,6-7H,5H2,1H3 |
| InChIKey | OBBCLWDZIQWJSC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|