C21H18F3N3O — CID 67890322
N-[4-[2-(methoxymethyl)phenyl]but-3-ynyl]-8-(trifluoromethyl)quinazolin-4-amine (PubChem CID 67890322) has the molecular formula C21H18F3N3O and a molecular weight of 385.39 g/mol. Its IUPAC name is N-[4-[2-(methoxymethyl)phenyl]but-3-ynyl]-8-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-[4-[2-(methoxymethyl)phenyl]but-3-ynyl]-8-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 67890322 |
| Molecular Formula | C21H18F3N3O |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[4-[2-(methoxymethyl)phenyl]but-3-ynyl]-8-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COCc1ccccc1C#CCCNc1ncnc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C21H18F3N3O/c1-28-13-16-9-3-2-7-15(16)8-4-5-12-25-20-17-10-6-11-18(21(22,23)24)19(17)26-14-27-20/h2-3,6-7,9-11,14H,5,12-13H2,1H3,(H,25,26,27) |
| InChIKey | MSKMSJSTGCHMNU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|