C17H26O3 — CID 67897201
methyl 2-[(1S,2S,4R,7R)-7-acetyl-2-bicyclo[2.2.1]heptanyl]hept-2-enoate (PubChem CID 67897201) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 2-[(1S,2S,4R,7R)-7-acetyl-2-bicyclo[2.2.1]heptanyl]hept-2-enoate.
| Compound Name | methyl 2-[(1S,2S,4R,7R)-7-acetyl-2-bicyclo[2.2.1]heptanyl]hept-2-enoate |
|---|---|
| PubChem CID | 67897201 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 2-[(1S,2S,4R,7R)-7-acetyl-2-bicyclo[2.2.1]heptanyl]hept-2-enoate |
| SMILES | CCCCC=C(C(=O)OC)[C@H]1C[C@H]2CC[C@@H]1[C@@H]2C(C)=O |
| InChI | InChI=1S/C17H26O3/c1-4-5-6-7-14(17(19)20-3)15-10-12-8-9-13(15)16(12)11(2)18/h7,12-13,15-16H,4-6,8-10H2,1-3H3/t12-,13+,15+,16-/m1/s1 |
| InChIKey | AGNXJNPPQHTEDN-BFJAYTPKSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|