C17H24N2O6S — CID 67897661
(6R)-8-oxo-3-(3-oxobutanoyloxymethyl)-7-(pentylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 67897661) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is (6R)-8-oxo-3-(3-oxobutanoyloxymethyl)-7-(pentylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-8-oxo-3-(3-oxobutanoyloxymethyl)-7-(pentylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 67897661 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (6R)-8-oxo-3-(3-oxobutanoyloxymethyl)-7-(pentylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCCCNC1C(=O)N2C(C(=O)O)=C(COC(=O)CC(C)=O)CS[C@H]12 |
| InChI | InChI=1S/C17H24N2O6S/c1-3-4-5-6-18-13-15(22)19-14(17(23)24)11(9-26-16(13)19)8-25-12(21)7-10(2)20/h13,16,18H,3-9H2,1-2H3,(H,23,24)/t13?,16-/m1/s1 |
| InChIKey | LQTNCLWKXPKEJD-FQNRMIAFSA-N |
| XLogP | 0.91 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|