C23H40O — CID 67898727
1-[[(Z)-but-2-enoxy]methyl]-4-[4-[(E)-hex-3-enyl]cyclohexyl]cyclohexane (PubChem CID 67898727) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is 1-[[(Z)-but-2-enoxy]methyl]-4-[4-[(E)-hex-3-enyl]cyclohexyl]cyclohexane.
| Compound Name | 1-[[(Z)-but-2-enoxy]methyl]-4-[4-[(E)-hex-3-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 67898727 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | 1-[[(Z)-but-2-enoxy]methyl]-4-[4-[(E)-hex-3-enyl]cyclohexyl]cyclohexane |
| SMILES | C/C=C\COCC1CCC(C2CCC(CC/C=C/CC)CC2)CC1 |
| InChI | InChI=1S/C23H40O/c1-3-5-7-8-9-20-10-14-22(15-11-20)23-16-12-21(13-17-23)19-24-18-6-4-2/h4-7,20-23H,3,8-19H2,1-2H3/b6-4-,7-5+ |
| InChIKey | MZXYXIDWYXVUEZ-XGXWUAJZSA-N |
| XLogP | 6.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|