C21H38O — CID 67898877
1-[[(Z)-but-2-enoxy]methyl]-4-(4-butylcyclohexyl)cyclohexane (PubChem CID 67898877) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is 1-[[(Z)-but-2-enoxy]methyl]-4-(4-butylcyclohexyl)cyclohexane.
| Compound Name | 1-[[(Z)-but-2-enoxy]methyl]-4-(4-butylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 67898877 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 1-[[(Z)-but-2-enoxy]methyl]-4-(4-butylcyclohexyl)cyclohexane |
| SMILES | C/C=C\COCC1CCC(C2CCC(CCCC)CC2)CC1 |
| InChI | InChI=1S/C21H38O/c1-3-5-7-18-8-12-20(13-9-18)21-14-10-19(11-15-21)17-22-16-6-4-2/h4,6,18-21H,3,5,7-17H2,1-2H3/b6-4- |
| InChIKey | QQTOHLNHAGHGRQ-XQRVVYSFSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|