C17H22ClN3 — CID 67901256
1-[1-(2,3,3a,4,5,6-hexahydro-1H-phenalen-2-yl)ethyl]-1,2,4-triazole;hydrochloride (PubChem CID 67901256) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 1-[1-(2,3,3a,4,5,6-hexahydro-1H-phenalen-2-yl)ethyl]-1,2,4-triazole;hydrochloride.
| Compound Name | 1-[1-(2,3,3a,4,5,6-hexahydro-1H-phenalen-2-yl)ethyl]-1,2,4-triazole;hydrochloride |
|---|---|
| PubChem CID | 67901256 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-[1-(2,3,3a,4,5,6-hexahydro-1H-phenalen-2-yl)ethyl]-1,2,4-triazole;hydrochloride |
| SMILES | CC(C1Cc2cccc3c2C(CCC3)C1)n1cncn1.Cl |
| InChI | InChI=1S/C17H21N3.ClH/c1-12(20-11-18-10-19-20)16-8-14-6-2-4-13-5-3-7-15(9-16)17(13)14;/h2,4,6,10-12,15-16H,3,5,7-9H2,1H3;1H |
| InChIKey | SGOORVFKUVVVMO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |