C13H17N3 — CID 25170871
1-[(3S)-3-phenylpentyl]-1,2,4-triazole (PubChem CID 25170871) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-[(3S)-3-phenylpentyl]-1,2,4-triazole.
| Compound Name | 1-[(3S)-3-phenylpentyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 25170871 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1-[(3S)-3-phenylpentyl]-1,2,4-triazole |
| SMILES | CC[C@@H](CCn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C13H17N3/c1-2-12(13-6-4-3-5-7-13)8-9-16-11-14-10-15-16/h3-7,10-12H,2,8-9H2,1H3/t12-/m0/s1 |
| InChIKey | YRAYCMUIHGZPKZ-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |