C18H20N4O3 — CID 67902718
tert-butyl N-[3-oxo-2-(pyridin-3-ylmethyl)-1H-indazol-4-yl]carbamate (PubChem CID 67902718) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-2-(pyridin-3-ylmethyl)-1H-indazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-2-(pyridin-3-ylmethyl)-1H-indazol-4-yl]carbamate |
|---|---|
| PubChem CID | 67902718 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl N-[3-oxo-2-(pyridin-3-ylmethyl)-1H-indazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc2[nH]n(Cc3cccnc3)c(=O)c12 |
| InChI | InChI=1S/C18H20N4O3/c1-18(2,3)25-17(24)20-13-7-4-8-14-15(13)16(23)22(21-14)11-12-6-5-9-19-10-12/h4-10,21H,11H2,1-3H3,(H,20,24) |
| InChIKey | GYPFUVBKCOHOMC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|