C9H18NO12P — CID 67908754
2-(phosphonomethylamino)acetic acid;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid (PubChem CID 67908754) has the molecular formula C9H18NO12P and a molecular weight of 363.21 g/mol. Its IUPAC name is 2-(phosphonomethylamino)acetic acid;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid.
| Compound Name | 2-(phosphonomethylamino)acetic acid;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 67908754 |
| Molecular Formula | C9H18NO12P |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-(phosphonomethylamino)acetic acid;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)CNCP(=O)(O)O.O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O7.C3H8NO5P/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;5-3(6)1-4-2-10(7,8)9/h1-4,6-9,12H,(H,10,11);4H,1-2H2,(H,5,6)(H2,7,8,9)/t1-,2-,3+,4-,6?;/m0./s1 |
| InChIKey | ZQNVKSDWQKSJKO-KZUGWDFCSA-N |
| XLogP | -4.33 |
| TPSA | 234.31 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|