About 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine
3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine (PubChem CID 67909576) has the molecular formula C16H22N2O
and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine.
Molecular Properties
| Compound Name | 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine |
| PubChem CID | 67909576 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine |
| SMILES | Cc1ccc[nH]c1=O.NCCCCc1ccccc1 |
| InChI | InChI=1S/C10H15N.C6H7NO/c11-9-5-4-8-10-6-2-1-3-7-10;1-5-3-2-4-7-6(5)8/h1-3,6-7H,4-5,8-9,11H2;2-4H,1H3,(H,7,8) |
| InChIKey | XHWAOKMVDPJLFP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine?
The IUPAC name of 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine (CID 67909576) is 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine.
What is the SMILES notation for 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine?
The canonical SMILES for 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine is Cc1ccc[nH]c1=O.NCCCCc1ccccc1.
What is the InChIKey of 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine?
The InChIKey is XHWAOKMVDPJLFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C6H7NO/c11-9-5-4-8-10-6-2-1-3-7-10;1-5-3-2-4-7-6(5)8/h1-3,6-7H,4-5,8-9,11H2;2-4H,1H3,(H,7,8).
What are the key properties of 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine?
3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine has a molecular weight of 258.37 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-pyridin-2-one;4-phenylbutan-1-amine is sourced from PubChem (CID 67909576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).