C32H32N8O2 — CID 67910307
2-[2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 67910307) has the molecular formula C32H32N8O2 and a molecular weight of 560.66 g/mol. Its IUPAC name is 2-[2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67910307 |
| Molecular Formula | C32H32N8O2 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 2-[2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CCCCc1nc2ccc(N3C(=O)C4CCCCC4C3=O)nc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H32N8O2/c1-2-3-12-27-33-26-17-18-28(40-31(41)24-10-6-7-11-25(24)32(40)42)34-30(26)39(27)19-20-13-15-21(16-14-20)22-8-4-5-9-23(22)29-35-37-38-36-29/h4-5,8-9,13-18,24-25H,2-3,6-7,10-12,19H2,1H3,(H,35,36,37,38) |
| InChIKey | ZBMBRAKFCYCWCM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|