C22H34O5 — CID 67913632
2,6-dihydroxy-4,5-di(octanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 67913632) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2,6-dihydroxy-4,5-di(octanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 2,6-dihydroxy-4,5-di(octanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 67913632 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2,6-dihydroxy-4,5-di(octanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CCCCCCCC(=O)C1=C(C(=O)CCCCCCC)C(O)C(=O)C(O)=C1 |
| InChI | InChI=1S/C22H34O5/c1-3-5-7-9-11-13-17(23)16-15-19(25)21(26)22(27)20(16)18(24)14-12-10-8-6-4-2/h15,22,25,27H,3-14H2,1-2H3 |
| InChIKey | UPPITZDKWKRXGI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|