C15H17NO4 — CID 67914490
[(Z)-6-(dimethylamino)-2,4-dioxohex-5-en-3-yl] benzoate (PubChem CID 67914490) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is [(Z)-6-(dimethylamino)-2,4-dioxohex-5-en-3-yl] benzoate.
| Compound Name | [(Z)-6-(dimethylamino)-2,4-dioxohex-5-en-3-yl] benzoate |
|---|---|
| PubChem CID | 67914490 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | [(Z)-6-(dimethylamino)-2,4-dioxohex-5-en-3-yl] benzoate |
| SMILES | CC(=O)C(OC(=O)c1ccccc1)C(=O)/C=C\N(C)C |
| InChI | InChI=1S/C15H17NO4/c1-11(17)14(13(18)9-10-16(2)3)20-15(19)12-7-5-4-6-8-12/h4-10,14H,1-3H3/b10-9- |
| InChIKey | DJAFRBRAKKKJJU-KTKRTIGZSA-N |
| XLogP | 1.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|