C24H24O8 — CID 19873351
2,4-dioxopentan-3-yl benzoate;[(E)-2-hydroxy-4-oxopent-2-en-3-yl] benzoate (PubChem CID 19873351) has the molecular formula C24H24O8 and a molecular weight of 440.45 g/mol. Its IUPAC name is 2,4-dioxopentan-3-yl benzoate;[(E)-2-hydroxy-4-oxopent-2-en-3-yl] benzoate.
| Compound Name | 2,4-dioxopentan-3-yl benzoate;[(E)-2-hydroxy-4-oxopent-2-en-3-yl] benzoate |
|---|---|
| PubChem CID | 19873351 |
| Molecular Formula | C24H24O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2,4-dioxopentan-3-yl benzoate;[(E)-2-hydroxy-4-oxopent-2-en-3-yl] benzoate |
| SMILES | CC(=O)/C(OC(=O)c1ccccc1)=C(/C)O.CC(=O)C(OC(=O)c1ccccc1)C(C)=O |
| InChI | InChI=1S/2C12H12O4/c2*1-8(13)11(9(2)14)16-12(15)10-6-4-3-5-7-10/h3-7,13H,1-2H3;3-7,11H,1-2H3/b11-8+; |
| InChIKey | BWUGMVZFNJTQEX-YGCVIUNWSA-N |
| XLogP | 3.61 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|