About iron;2-oxopropanoyl benzoate
iron;2-oxopropanoyl benzoate (PubChem CID 174449626) has the molecular formula C10H8FeO4
and a molecular weight of 248.01 g/mol. Its IUPAC name is iron;2-oxopropanoyl benzoate.
Molecular Properties
| Compound Name | iron;2-oxopropanoyl benzoate |
| PubChem CID | 174449626 |
| Molecular Formula | C10H8FeO4 |
| Molecular Weight | 248.01 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | iron;2-oxopropanoyl benzoate |
| SMILES | CC(=O)C(=O)OC(=O)c1ccccc1.[Fe] |
| InChI | InChI=1S/C10H8O4.Fe/c1-7(11)9(12)14-10(13)8-5-3-2-4-6-8;/h2-6H,1H3; |
| InChIKey | RZRSUQZCCRMDKW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.01 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;2-oxopropanoyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2-oxopropanoyl benzoate?
The IUPAC name of iron;2-oxopropanoyl benzoate (CID 174449626) is iron;2-oxopropanoyl benzoate.
What is the SMILES notation for iron;2-oxopropanoyl benzoate?
The canonical SMILES for iron;2-oxopropanoyl benzoate is CC(=O)C(=O)OC(=O)c1ccccc1.[Fe].
What is the InChIKey of iron;2-oxopropanoyl benzoate?
The InChIKey is RZRSUQZCCRMDKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4.Fe/c1-7(11)9(12)14-10(13)8-5-3-2-4-6-8;/h2-6H,1H3;.
What are the key properties of iron;2-oxopropanoyl benzoate?
iron;2-oxopropanoyl benzoate has a molecular weight of 248.01 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2-oxopropanoyl benzoate is sourced from PubChem (CID 174449626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).