About 3-oxobut-1-en-2-yl benzoate
3-oxobut-1-en-2-yl benzoate (PubChem CID 12671077) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-oxobut-1-en-2-yl benzoate.
Molecular Properties
| Compound Name | 3-oxobut-1-en-2-yl benzoate |
| PubChem CID | 12671077 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-oxobut-1-en-2-yl benzoate |
| SMILES | C=C(OC(=O)c1ccccc1)C(C)=O |
| InChI | InChI=1S/C11H10O3/c1-8(12)9(2)14-11(13)10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
| InChIKey | QEPUUHCFGJBAQE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobut-1-en-2-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobut-1-en-2-yl benzoate?
The IUPAC name of 3-oxobut-1-en-2-yl benzoate (CID 12671077) is 3-oxobut-1-en-2-yl benzoate.
What is the SMILES notation for 3-oxobut-1-en-2-yl benzoate?
The canonical SMILES for 3-oxobut-1-en-2-yl benzoate is C=C(OC(=O)c1ccccc1)C(C)=O.
What is the InChIKey of 3-oxobut-1-en-2-yl benzoate?
The InChIKey is QEPUUHCFGJBAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-8(12)9(2)14-11(13)10-6-4-3-5-7-10/h3-7H,2H2,1H3.
What are the key properties of 3-oxobut-1-en-2-yl benzoate?
3-oxobut-1-en-2-yl benzoate has a molecular weight of 190.20 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobut-1-en-2-yl benzoate is sourced from PubChem (CID 12671077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).