C14H13FO2 — CID 129203504
[(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl] benzoate (PubChem CID 129203504) has the molecular formula C14H13FO2 and a molecular weight of 232.25 g/mol. Its IUPAC name is [(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl] benzoate.
| Compound Name | [(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl] benzoate |
|---|---|
| PubChem CID | 129203504 |
| Molecular Formula | C14H13FO2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [(3E)-4-fluoro-5-methylhexa-1,3,5-trien-2-yl] benzoate |
| SMILES | C=C(/C=C(/F)C(=C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13FO2/c1-10(2)13(15)9-11(3)17-14(16)12-7-5-4-6-8-12/h4-9H,1,3H2,2H3/b13-9+ |
| InChIKey | JRLMQNDKCIQRPX-UKTHLTGXSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|