About (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate
(3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate (PubChem CID 174417221) has the molecular formula C24H16O6
and a molecular weight of 400.39 g/mol. Its IUPAC name is (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate.
Molecular Properties
| Compound Name | (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate |
| PubChem CID | 174417221 |
| Molecular Formula | C24H16O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate |
| SMILES | O=C(OC(=O)c1ccccc1)C(=O)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H16O6/c25-20(16-10-4-1-5-11-16)19(21(26)17-12-6-2-7-13-17)22(27)24(29)30-23(28)18-14-8-3-9-15-18/h1-15,19H |
| InChIKey | XZMOTXFNVJDNMC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate?
The IUPAC name of (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate (CID 174417221) is (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate.
What is the SMILES notation for (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate?
The canonical SMILES for (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate is O=C(OC(=O)c1ccccc1)C(=O)C(C(=O)c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate?
The InChIKey is XZMOTXFNVJDNMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16O6/c25-20(16-10-4-1-5-11-16)19(21(26)17-12-6-2-7-13-17)22(27)24(29)30-23(28)18-14-8-3-9-15-18/h1-15,19H.
What are the key properties of (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate?
(3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate has a molecular weight of 400.39 g/mol, XLogP of 3.32, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyl-2,4-dioxo-4-phenylbutanoyl) benzoate is sourced from PubChem (CID 174417221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).