C12H11FN2O4 — CID 67914833
1-(4-fluorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylic acid (PubChem CID 67914833) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylic acid.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67914833 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CC(C(=O)O)=NN1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FN2O4/c1-12(11(18)19)6-9(10(16)17)14-15(12)8-4-2-7(13)3-5-8/h2-5H,6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | XWAQZRYGXTVWCL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |