C27H28ClN3O4 — CID 67918962
3-[[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbonyl]amino]propyl 2-(4-chlorophenoxy)acetate (PubChem CID 67918962) has the molecular formula C27H28ClN3O4 and a molecular weight of 493.99 g/mol. Its IUPAC name is 3-[[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbonyl]amino]propyl 2-(4-chlorophenoxy)acetate.
| Compound Name | 3-[[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbonyl]amino]propyl 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 67918962 |
| Molecular Formula | C27H28ClN3O4 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 3-[[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbonyl]amino]propyl 2-(4-chlorophenoxy)acetate |
| SMILES | CN1C[C@H](C(=O)NCCCOC(=O)COc2ccc(Cl)cc2)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C27H28ClN3O4/c1-31-15-18(12-22-21-4-2-5-23-26(21)17(14-30-23)13-24(22)31)27(33)29-10-3-11-34-25(32)16-35-20-8-6-19(28)7-9-20/h2,4-9,12,14,18,24,30H,3,10-11,13,15-16H2,1H3,(H,29,33)/t18-,24-/m1/s1 |
| InChIKey | DIFMSKFTEXGWSC-HOYKHHGWSA-N |
| XLogP | 3.82 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|