About CID 67919173
CID 67919173 (PubChem CID 67919173) has the molecular formula C12H19Sn
and a molecular weight of 282.00 g/mol.
Molecular Properties
| Compound Name | CID 67919173 |
| PubChem CID | 67919173 |
| Molecular Formula | C12H19Sn |
| Molecular Weight | 282.00 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | — |
| SMILES | CC[Sn](c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C6H5.C4H9.C2H5.Sn/c1-2-4-6-5-3-1;1-4(2)3;1-2;/h1-5H;1-3H3;1H2,2H3; |
| InChIKey | WTMCNTMXTOWVFY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.00 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 67919173 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67919173?
The IUPAC name of CID 67919173 (CID 67919173) is not available.
What is the SMILES notation for CID 67919173?
The canonical SMILES for CID 67919173 is CC[Sn](c1ccccc1)C(C)(C)C.
What is the InChIKey of CID 67919173?
The InChIKey is WTMCNTMXTOWVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.C4H9.C2H5.Sn/c1-2-4-6-5-3-1;1-4(2)3;1-2;/h1-5H;1-3H3;1H2,2H3;.
What are the key properties of CID 67919173?
CID 67919173 has a molecular weight of 282.00 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67919173 is sourced from PubChem (CID 67919173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).