C22H37N — CID 67922584
1-[(E)-hex-3-enyl]-4-(4-propylcyclohexyl)cyclohexane-1-carbonitrile (PubChem CID 67922584) has the molecular formula C22H37N and a molecular weight of 315.54 g/mol. Its IUPAC name is 1-[(E)-hex-3-enyl]-4-(4-propylcyclohexyl)cyclohexane-1-carbonitrile.
| Compound Name | 1-[(E)-hex-3-enyl]-4-(4-propylcyclohexyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 67922584 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.54 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | 1-[(E)-hex-3-enyl]-4-(4-propylcyclohexyl)cyclohexane-1-carbonitrile |
| SMILES | CC/C=C/CCC1(C#N)CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C22H37N/c1-3-5-6-7-15-22(18-23)16-13-21(14-17-22)20-11-9-19(8-4-2)10-12-20/h5-6,19-21H,3-4,7-17H2,1-2H3/b6-5+ |
| InChIKey | BZXRKTZZWZYZFR-AATRIKPKSA-N |
| XLogP | 7.04 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.54 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|