C24H41N — CID 67922597
4-(4-butylcyclohexyl)-1-[(Z)-hept-3-enyl]cyclohexane-1-carbonitrile (PubChem CID 67922597) has the molecular formula C24H41N and a molecular weight of 343.60 g/mol. Its IUPAC name is 4-(4-butylcyclohexyl)-1-[(Z)-hept-3-enyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-(4-butylcyclohexyl)-1-[(Z)-hept-3-enyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 67922597 |
| Molecular Formula | C24H41N |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | 4-(4-butylcyclohexyl)-1-[(Z)-hept-3-enyl]cyclohexane-1-carbonitrile |
| SMILES | CCC/C=C\CCC1(C#N)CCC(C2CCC(CCCC)CC2)CC1 |
| InChI | InChI=1S/C24H41N/c1-3-5-7-8-9-17-24(20-25)18-15-23(16-19-24)22-13-11-21(12-14-22)10-6-4-2/h7-8,21-23H,3-6,9-19H2,1-2H3/b8-7- |
| InChIKey | DIHUTHWXVAFHRP-FPLPWBNLSA-N |
| XLogP | 7.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|