C26H29N3O5S — CID 67925663
but-2-enedioic acid;2-[methyl-[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]-1,3-benzothiazol-5-ol (PubChem CID 67925663) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is but-2-enedioic acid;2-[methyl-[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]-1,3-benzothiazol-5-ol.
| Compound Name | but-2-enedioic acid;2-[methyl-[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]-1,3-benzothiazol-5-ol |
|---|---|
| PubChem CID | 67925663 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | but-2-enedioic acid;2-[methyl-[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]-1,3-benzothiazol-5-ol |
| SMILES | CN(c1nc2cc(O)ccc2s1)C1CCN(CC=Cc2ccccc2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C22H25N3OS.C4H4O4/c1-24(22-23-20-16-19(26)9-10-21(20)27-22)18-11-14-25(15-12-18)13-5-8-17-6-3-2-4-7-17;5-3(6)1-2-4(7)8/h2-10,16,18,26H,11-15H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GKCUGCCRVVMMPT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|