C8H12N2O4S — CID 67928610
(5R)-6-amino-3-methoxy-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 67928610) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is (5R)-6-amino-3-methoxy-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (5R)-6-amino-3-methoxy-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 67928610 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (5R)-6-amino-3-methoxy-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | COC1(C)S[C@@H]2C(N)C(=O)N2C1C(=O)O |
| InChI | InChI=1S/C8H12N2O4S/c1-8(14-2)4(7(12)13)10-5(11)3(9)6(10)15-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3?,4?,6-,8?/m1/s1 |
| InChIKey | WUMGVARYVCKLLU-VXGDOOMISA-N |
| XLogP | -0.96 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |