C12H23N3O4 — CID 67929893
[4-[(3-amino-3-methylbutanoyl)amino]cyclohexyl]methyl nitrate (PubChem CID 67929893) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is [4-[(3-amino-3-methylbutanoyl)amino]cyclohexyl]methyl nitrate.
| Compound Name | [4-[(3-amino-3-methylbutanoyl)amino]cyclohexyl]methyl nitrate |
|---|---|
| PubChem CID | 67929893 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [4-[(3-amino-3-methylbutanoyl)amino]cyclohexyl]methyl nitrate |
| SMILES | CC(C)(N)CC(=O)NC1CCC(CO[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H23N3O4/c1-12(2,13)7-11(16)14-10-5-3-9(4-6-10)8-19-15(17)18/h9-10H,3-8,13H2,1-2H3,(H,14,16) |
| InChIKey | FJIITTTUCJLFIC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|