C28H33N3O5 — CID 67930085
but-2-enedioic acid;N-[3-(diethylamino)-1-phenylpropyl]-2-quinolin-2-ylacetamide (PubChem CID 67930085) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is but-2-enedioic acid;N-[3-(diethylamino)-1-phenylpropyl]-2-quinolin-2-ylacetamide.
| Compound Name | but-2-enedioic acid;N-[3-(diethylamino)-1-phenylpropyl]-2-quinolin-2-ylacetamide |
|---|---|
| PubChem CID | 67930085 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | but-2-enedioic acid;N-[3-(diethylamino)-1-phenylpropyl]-2-quinolin-2-ylacetamide |
| SMILES | CCN(CC)CCC(NC(=O)Cc1ccc2ccccc2n1)c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H29N3O.C4H4O4/c1-3-27(4-2)17-16-23(19-10-6-5-7-11-19)26-24(28)18-21-15-14-20-12-8-9-13-22(20)25-21;5-3(6)1-2-4(7)8/h5-15,23H,3-4,16-18H2,1-2H3,(H,26,28);1-2H,(H,5,6)(H,7,8) |
| InChIKey | HIVPZEZBVFNZFN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|