C18H26O4 — CID 67930268
[4-hydroxy-4-(4-pentylphenyl)cyclohexyl] hydrogen carbonate (PubChem CID 67930268) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is [4-hydroxy-4-(4-pentylphenyl)cyclohexyl] hydrogen carbonate.
| Compound Name | [4-hydroxy-4-(4-pentylphenyl)cyclohexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67930268 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [4-hydroxy-4-(4-pentylphenyl)cyclohexyl] hydrogen carbonate |
| SMILES | CCCCCc1ccc(C2(O)CCC(OC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H26O4/c1-2-3-4-5-14-6-8-15(9-7-14)18(21)12-10-16(11-13-18)22-17(19)20/h6-9,16,21H,2-5,10-13H2,1H3,(H,19,20) |
| InChIKey | PVVQZXHODAYTSA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|