C22H34O3 — CID 19986794
propyl 4-(4-hexylphenyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 19986794) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is propyl 4-(4-hexylphenyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | propyl 4-(4-hexylphenyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19986794 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | propyl 4-(4-hexylphenyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCCCCCc1ccc(C2(O)CCC(C(=O)OCCC)CC2)cc1 |
| InChI | InChI=1S/C22H34O3/c1-3-5-6-7-8-18-9-11-20(12-10-18)22(24)15-13-19(14-16-22)21(23)25-17-4-2/h9-12,19,24H,3-8,13-17H2,1-2H3 |
| InChIKey | VJABSHVDTVOVGE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|