C19H25F3N2O3S — CID 67936093
2-[1-[4-(2-ethoxyethoxy)phenyl]propan-2-ylamino]-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 67936093) has the molecular formula C19H25F3N2O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-[1-[4-(2-ethoxyethoxy)phenyl]propan-2-ylamino]-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-[1-[4-(2-ethoxyethoxy)phenyl]propan-2-ylamino]-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 67936093 |
| Molecular Formula | C19H25F3N2O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[1-[4-(2-ethoxyethoxy)phenyl]propan-2-ylamino]-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CCOCCOc1ccc(CC(C)NCC(O)c2csc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H25F3N2O3S/c1-3-26-8-9-27-15-6-4-14(5-7-15)10-13(2)23-11-17(25)16-12-28-18(24-16)19(20,21)22/h4-7,12-13,17,23,25H,3,8-11H2,1-2H3 |
| InChIKey | UUACOBFJAAOGEN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|