C12H25N3 — CID 67937097
1,5-dipentyl-4,5-dihydrotriazole (PubChem CID 67937097) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 1,5-dipentyl-4,5-dihydrotriazole.
| Compound Name | 1,5-dipentyl-4,5-dihydrotriazole |
|---|---|
| PubChem CID | 67937097 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1,5-dipentyl-4,5-dihydrotriazole |
| SMILES | CCCCCC1CN=NN1CCCCC |
| InChI | InChI=1S/C12H25N3/c1-3-5-7-9-12-11-13-14-15(12)10-8-6-4-2/h12H,3-11H2,1-2H3 |
| InChIKey | SIQQMJMYDJIBAQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|