C11H23N3O2 — CID 12538939
1-(2-ethoxyethyl)-5-pentoxy-4,5-dihydrotriazole (PubChem CID 12538939) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-pentoxy-4,5-dihydrotriazole.
| Compound Name | 1-(2-ethoxyethyl)-5-pentoxy-4,5-dihydrotriazole |
|---|---|
| PubChem CID | 12538939 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-pentoxy-4,5-dihydrotriazole |
| SMILES | CCCCCOC1CN=NN1CCOCC |
| InChI | InChI=1S/C11H23N3O2/c1-3-5-6-8-16-11-10-12-13-14(11)7-9-15-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | KHUSFAUZBUHGQG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|