About dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane
dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane (PubChem CID 67939368) has the molecular formula C26H48O4Si2
and a molecular weight of 480.84 g/mol. Its IUPAC name is dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane.
Molecular Properties
| Compound Name | dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane |
| PubChem CID | 67939368 |
| Molecular Formula | C26H48O4Si2 |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane |
| SMILES | CCCO[Si](CC)(OC)c1ccccc1.CO[Si](OC)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H28O2Si.C12H20O2Si/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-4-11-14-15(5-2,13-3)12-9-7-6-8-10-12/h13-14H,3-12H2,1-2H3;6-10H,4-5,11H2,1-3H3 |
| InChIKey | LDZWOPVXVWIECH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane?
The IUPAC name of dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane (CID 67939368) is dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane.
What is the SMILES notation for dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane?
The canonical SMILES for dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane is CCCO[Si](CC)(OC)c1ccccc1.CO[Si](OC)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane?
The InChIKey is LDZWOPVXVWIECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2Si.C12H20O2Si/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-4-11-14-15(5-2,13-3)12-9-7-6-8-10-12/h13-14H,3-12H2,1-2H3;6-10H,4-5,11H2,1-3H3.
What are the key properties of dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane?
dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane has a molecular weight of 480.84 g/mol, XLogP of 6.82, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl(dimethoxy)silane;ethyl-methoxy-phenyl-propoxysilane is sourced from PubChem (CID 67939368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).