C19H26O2Si — CID 139803126
cyclohexyl-dimethoxy-(3-phenylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139803126) has the molecular formula C19H26O2Si and a molecular weight of 314.50 g/mol. Its IUPAC name is cyclohexyl-dimethoxy-(3-phenylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | cyclohexyl-dimethoxy-(3-phenylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139803126 |
| Molecular Formula | C19H26O2Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | cyclohexyl-dimethoxy-(3-phenylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CO[Si](OC)(C1C=CC(c2ccccc2)=C1)C1CCCCC1 |
| InChI | InChI=1S/C19H26O2Si/c1-20-22(21-2,18-11-7-4-8-12-18)19-14-13-17(15-19)16-9-5-3-6-10-16/h3,5-6,9-10,13-15,18-19H,4,7-8,11-12H2,1-2H3 |
| InChIKey | SWZIHCOXGDSXNG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|