About cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane
cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane (PubChem CID 139803106) has the molecular formula C18H26O2Si
and a molecular weight of 302.49 g/mol. Its IUPAC name is cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane.
Molecular Properties
| Compound Name | cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane |
| PubChem CID | 139803106 |
| Molecular Formula | C18H26O2Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane |
| SMILES | CO[Si](OC)(C1CCCC1)C1C(C)=Cc2c(C)cccc21 |
| InChI | InChI=1S/C18H26O2Si/c1-13-8-7-11-16-17(13)12-14(2)18(16)21(19-3,20-4)15-9-5-6-10-15/h7-8,11-12,15,18H,5-6,9-10H2,1-4H3 |
| InChIKey | OWPYCRXLGXEYMQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane?
The IUPAC name of cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane (CID 139803106) is cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane.
What is the SMILES notation for cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane?
The canonical SMILES for cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane is CO[Si](OC)(C1CCCC1)C1C(C)=Cc2c(C)cccc21.
What is the InChIKey of cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane?
The InChIKey is OWPYCRXLGXEYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O2Si/c1-13-8-7-11-16-17(13)12-14(2)18(16)21(19-3,20-4)15-9-5-6-10-15/h7-8,11-12,15,18H,5-6,9-10H2,1-4H3.
What are the key properties of cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane?
cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane has a molecular weight of 302.49 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-(2,4-dimethyl-1H-inden-1-yl)-dimethoxysilane is sourced from PubChem (CID 139803106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).