C28H39N3O3 — CID 67940510
N-(2,6-ditert-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxopropanamide (PubChem CID 67940510) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-(2,6-ditert-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxopropanamide.
| Compound Name | N-(2,6-ditert-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 67940510 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-(2,6-ditert-butylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxopropanamide |
| SMILES | COc1ccccc1N1CCN(CC(=O)C(=O)Nc2c(C(C)(C)C)cccc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C28H39N3O3/c1-27(2,3)20-11-10-12-21(28(4,5)6)25(20)29-26(33)23(32)19-30-15-17-31(18-16-30)22-13-8-9-14-24(22)34-7/h8-14H,15-19H2,1-7H3,(H,29,33) |
| InChIKey | FDFJXIRENGVBGX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|