C24H23ClN4O — CID 67941288
2-[5-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]-1H-indol-2-yl]benzonitrile (PubChem CID 67941288) has the molecular formula C24H23ClN4O and a molecular weight of 418.93 g/mol. Its IUPAC name is 2-[5-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]-1H-indol-2-yl]benzonitrile.
| Compound Name | 2-[5-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]-1H-indol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 67941288 |
| Molecular Formula | C24H23ClN4O |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[5-[[2-butyl-4-chloro-5-(hydroxymethyl)imidazol-1-yl]methyl]-1H-indol-2-yl]benzonitrile |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc2[nH]c(-c3ccccc3C#N)cc2c1 |
| InChI | InChI=1S/C24H23ClN4O/c1-2-3-8-23-28-24(25)22(15-30)29(23)14-16-9-10-20-18(11-16)12-21(27-20)19-7-5-4-6-17(19)13-26/h4-7,9-12,27,30H,2-3,8,14-15H2,1H3 |
| InChIKey | QAIVAVIINOMLGR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |