C9H14N4O2 — CID 67941499
3-methyl-N,N-bis(methylamino)-4-nitroaniline (PubChem CID 67941499) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-methyl-N,N-bis(methylamino)-4-nitroaniline.
| Compound Name | 3-methyl-N,N-bis(methylamino)-4-nitroaniline |
|---|---|
| PubChem CID | 67941499 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-methyl-N,N-bis(methylamino)-4-nitroaniline |
| SMILES | CNN(NC)c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H14N4O2/c1-7-6-8(12(10-2)11-3)4-5-9(7)13(14)15/h4-6,10-11H,1-3H3 |
| InChIKey | SEHIIWYGSXZLQX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|