C18H21ClF3N — CID 67944421
methyl-[3-phenyl-4-[4-(trifluoromethyl)phenyl]butyl]azanium chloride (PubChem CID 67944421) has the molecular formula C18H21ClF3N and a molecular weight of 343.82 g/mol. Its IUPAC name is methyl-[3-phenyl-4-[4-(trifluoromethyl)phenyl]butyl]azanium chloride.
| Compound Name | methyl-[3-phenyl-4-[4-(trifluoromethyl)phenyl]butyl]azanium chloride |
|---|---|
| PubChem CID | 67944421 |
| Molecular Formula | C18H21ClF3N |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl-[3-phenyl-4-[4-(trifluoromethyl)phenyl]butyl]azanium chloride |
| SMILES | C[NH2+]CCC(Cc1ccc(C(F)(F)F)cc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H20F3N.ClH/c1-22-12-11-16(15-5-3-2-4-6-15)13-14-7-9-17(10-8-14)18(19,20)21;/h2-10,16,22H,11-13H2,1H3;1H |
| InChIKey | FWLUBAUAOOLPQV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |