C28H44O5S2 — CID 67944550
methyl 3-[1-(2-dodec-1-en-5-ylphenyl)-2-hydroxy-3-(2-methoxy-2-oxoethyl)sulfanylpropyl]sulfanylpropanoate (PubChem CID 67944550) has the molecular formula C28H44O5S2 and a molecular weight of 524.79 g/mol. Its IUPAC name is methyl 3-[1-(2-dodec-1-en-5-ylphenyl)-2-hydroxy-3-(2-methoxy-2-oxoethyl)sulfanylpropyl]sulfanylpropanoate.
| Compound Name | methyl 3-[1-(2-dodec-1-en-5-ylphenyl)-2-hydroxy-3-(2-methoxy-2-oxoethyl)sulfanylpropyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 67944550 |
| Molecular Formula | C28H44O5S2 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | methyl 3-[1-(2-dodec-1-en-5-ylphenyl)-2-hydroxy-3-(2-methoxy-2-oxoethyl)sulfanylpropyl]sulfanylpropanoate |
| SMILES | C=CCCC(CCCCCCC)c1ccccc1C(SCCC(=O)OC)C(O)CSCC(=O)OC |
| InChI | InChI=1S/C28H44O5S2/c1-5-7-9-10-11-15-22(14-8-6-2)23-16-12-13-17-24(23)28(35-19-18-26(30)32-3)25(29)20-34-21-27(31)33-4/h6,12-13,16-17,22,25,28-29H,2,5,7-11,14-15,18-21H2,1,3-4H3 |
| InChIKey | VXSSHWIIAJGFQE-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|