C11H19N2+ — CID 67945671
1,2,3,4a,5,6,7,8,9,9a-decahydrobenzo[7]annulen-4-ylidene(imino)azanium (PubChem CID 67945671) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is 1,2,3,4a,5,6,7,8,9,9a-decahydrobenzo[7]annulen-4-ylidene(imino)azanium.
| Compound Name | 1,2,3,4a,5,6,7,8,9,9a-decahydrobenzo[7]annulen-4-ylidene(imino)azanium |
|---|---|
| PubChem CID | 67945671 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | 1,2,3,4a,5,6,7,8,9,9a-decahydrobenzo[7]annulen-4-ylidene(imino)azanium |
| SMILES | N=[N+]=C1CCCC2CCCCCC12 |
| InChI | InChI=1S/C11H19N2/c12-13-11-8-4-6-9-5-2-1-3-7-10(9)11/h9-10,12H,1-8H2/q+1 |
| InChIKey | UOWDKLOBDGMEEC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|