C11H17N2+ — CID 19861217
5-diazo-2,3,4,4a,6,7,8,9-octahydro-1H-benzo[7]annulen-9a-ylium (PubChem CID 19861217) has the molecular formula C11H17N2+ and a molecular weight of 177.27 g/mol. Its IUPAC name is 5-diazo-2,3,4,4a,6,7,8,9-octahydro-1H-benzo[7]annulen-9a-ylium.
| Compound Name | 5-diazo-2,3,4,4a,6,7,8,9-octahydro-1H-benzo[7]annulen-9a-ylium |
|---|---|
| PubChem CID | 19861217 |
| Molecular Formula | C11H17N2+ |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | 5-diazo-2,3,4,4a,6,7,8,9-octahydro-1H-benzo[7]annulen-9a-ylium |
| SMILES | [N-]=[N+]=C1CCCC[C+]2CCCCC12 |
| InChI | InChI=1S/C11H17N2/c12-13-11-8-4-2-6-9-5-1-3-7-10(9)11/h10H,1-8H2/q+1 |
| InChIKey | RDZMSRAIOWTUPV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|