C20H32O5 — CID 67946449
butyl 4-(2-acetyloxyethoxy)butanoate;1,4-xylene (PubChem CID 67946449) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is butyl 4-(2-acetyloxyethoxy)butanoate;1,4-xylene.
| Compound Name | butyl 4-(2-acetyloxyethoxy)butanoate;1,4-xylene |
|---|---|
| PubChem CID | 67946449 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | butyl 4-(2-acetyloxyethoxy)butanoate;1,4-xylene |
| SMILES | CCCCOC(=O)CCCOCCOC(C)=O.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C12H22O5.C8H10/c1-3-4-8-17-12(14)6-5-7-15-9-10-16-11(2)13;1-7-3-5-8(2)6-4-7/h3-10H2,1-2H3;3-6H,1-2H3 |
| InChIKey | AMXBSRJXEPVHMC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|