C29H32N2O — CID 67946876
(3aR)-N-methyl-2-trityl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxamide (PubChem CID 67946876) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is (3aR)-N-methyl-2-trityl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxamide.
| Compound Name | (3aR)-N-methyl-2-trityl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxamide |
|---|---|
| PubChem CID | 67946876 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (3aR)-N-methyl-2-trityl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxamide |
| SMILES | CNC(=O)[C@]12CCCCC1CN(C(c1ccccc1)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C29H32N2O/c1-30-27(32)28-20-12-11-19-26(28)21-31(22-28)29(23-13-5-2-6-14-23,24-15-7-3-8-16-24)25-17-9-4-10-18-25/h2-10,13-18,26H,11-12,19-22H2,1H3,(H,30,32)/t26?,28-/m0/s1 |
| InChIKey | GKVKRRDJQWWHLC-RXBHZZDJSA-N |
| XLogP | 5.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|